C12H17Cl2N3O3S — CID 76910660
3-[(2,5-dichlorophenyl)sulfonyl-ethylamino]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 76910660) has the molecular formula C12H17Cl2N3O3S and a molecular weight of 354.26 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenyl)sulfonyl-ethylamino]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-[(2,5-dichlorophenyl)sulfonyl-ethylamino]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 76910660 |
| Molecular Formula | C12H17Cl2N3O3S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 3-[(2,5-dichlorophenyl)sulfonyl-ethylamino]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CCN(CC(C)C(N)=NO)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H17Cl2N3O3S/c1-3-17(7-8(2)12(15)16-18)21(19,20)11-6-9(13)4-5-10(11)14/h4-6,8,18H,3,7H2,1-2H3,(H2,15,16) |
| InChIKey | ULKXGIKIIJLTHP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|