C8H19N3O5S2 — CID 82843072
3-[ethyl(methylsulfonylmethylsulfonyl)amino]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 82843072) has the molecular formula C8H19N3O5S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-[ethyl(methylsulfonylmethylsulfonyl)amino]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-[ethyl(methylsulfonylmethylsulfonyl)amino]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 82843072 |
| Molecular Formula | C8H19N3O5S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 3-[ethyl(methylsulfonylmethylsulfonyl)amino]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CCN(CC(C)C(N)=NO)S(=O)(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C8H19N3O5S2/c1-4-11(5-7(2)8(9)10-12)18(15,16)6-17(3,13)14/h7,12H,4-6H2,1-3H3,(H2,9,10) |
| InChIKey | ZAPIMBNSSQHBPG-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|