C9H20N4O5S — CID 104929326
ethyl N-[(3-amino-3-hydroxyimino-2-methylpropyl)-ethylsulfamoyl]carbamate (PubChem CID 104929326) has the molecular formula C9H20N4O5S and a molecular weight of 296.35 g/mol. Its IUPAC name is ethyl N-[(3-amino-3-hydroxyimino-2-methylpropyl)-ethylsulfamoyl]carbamate.
| Compound Name | ethyl N-[(3-amino-3-hydroxyimino-2-methylpropyl)-ethylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 104929326 |
| Molecular Formula | C9H20N4O5S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | ethyl N-[(3-amino-3-hydroxyimino-2-methylpropyl)-ethylsulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N(CC)CC(C)C(N)=NO |
| InChI | InChI=1S/C9H20N4O5S/c1-4-13(6-7(3)8(10)11-15)19(16,17)12-9(14)18-5-2/h7,15H,4-6H2,1-3H3,(H2,10,11)(H,12,14) |
| InChIKey | LLTBCEOKNFNCPU-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|