C7H16N4O5S — CID 104929328
methyl N-[(3-amino-3-hydroxyiminopropyl)-ethylsulfamoyl]carbamate (PubChem CID 104929328) has the molecular formula C7H16N4O5S and a molecular weight of 268.29 g/mol. Its IUPAC name is methyl N-[(3-amino-3-hydroxyiminopropyl)-ethylsulfamoyl]carbamate.
| Compound Name | methyl N-[(3-amino-3-hydroxyiminopropyl)-ethylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 104929328 |
| Molecular Formula | C7H16N4O5S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | methyl N-[(3-amino-3-hydroxyiminopropyl)-ethylsulfamoyl]carbamate |
| SMILES | CCN(CCC(N)=NO)S(=O)(=O)NC(=O)OC |
| InChI | InChI=1S/C7H16N4O5S/c1-3-11(5-4-6(8)9-13)17(14,15)10-7(12)16-2/h13H,3-5H2,1-2H3,(H2,8,9)(H,10,12) |
| InChIKey | NULHMNXZLQLFFC-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|