C7H16N2O5S — CID 114464146
methyl N-[2-hydroxyethyl(propyl)sulfamoyl]carbamate (PubChem CID 114464146) has the molecular formula C7H16N2O5S and a molecular weight of 240.28 g/mol. Its IUPAC name is methyl N-[2-hydroxyethyl(propyl)sulfamoyl]carbamate.
| Compound Name | methyl N-[2-hydroxyethyl(propyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114464146 |
| Molecular Formula | C7H16N2O5S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | methyl N-[2-hydroxyethyl(propyl)sulfamoyl]carbamate |
| SMILES | CCCN(CCO)S(=O)(=O)NC(=O)OC |
| InChI | InChI=1S/C7H16N2O5S/c1-3-4-9(5-6-10)15(12,13)8-7(11)14-2/h10H,3-6H2,1-2H3,(H,8,11) |
| InChIKey | NQYLMSNAUYMRKV-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |