C9H22N4O3S — CID 104978381
3-[ethylsulfamoyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide (PubChem CID 104978381) has the molecular formula C9H22N4O3S and a molecular weight of 266.37 g/mol. Its IUPAC name is 3-[ethylsulfamoyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[ethylsulfamoyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 104978381 |
| Molecular Formula | C9H22N4O3S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 3-[ethylsulfamoyl(2-methylpropyl)amino]-N'-hydroxypropanimidamide |
| SMILES | CCNS(=O)(=O)N(CCC(N)=NO)CC(C)C |
| InChI | InChI=1S/C9H22N4O3S/c1-4-11-17(15,16)13(7-8(2)3)6-5-9(10)12-14/h8,11,14H,4-7H2,1-3H3,(H2,10,12) |
| InChIKey | GPXBHFTWTAJTRL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|