C11H20N4O3S2 — CID 103415668
N'-hydroxy-3-[2-methylpropyl-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]amino]propanimidamide (PubChem CID 103415668) has the molecular formula C11H20N4O3S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N'-hydroxy-3-[2-methylpropyl-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]amino]propanimidamide.
| Compound Name | N'-hydroxy-3-[2-methylpropyl-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]amino]propanimidamide |
|---|---|
| PubChem CID | 103415668 |
| Molecular Formula | C11H20N4O3S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N'-hydroxy-3-[2-methylpropyl-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]amino]propanimidamide |
| SMILES | Cc1ncc(S(=O)(=O)N(CCC(N)=NO)CC(C)C)s1 |
| InChI | InChI=1S/C11H20N4O3S2/c1-8(2)7-15(5-4-10(12)14-16)20(17,18)11-6-13-9(3)19-11/h6,8,16H,4-5,7H2,1-3H3,(H2,12,14) |
| InChIKey | JURFLUQCAXGDLP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|