C9H15N3O2S3 — CID 103414692
2-[(2-methyl-1,3-thiazol-5-yl)sulfonyl-propan-2-ylamino]ethanethioamide (PubChem CID 103414692) has the molecular formula C9H15N3O2S3 and a molecular weight of 293.44 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-5-yl)sulfonyl-propan-2-ylamino]ethanethioamide.
| Compound Name | 2-[(2-methyl-1,3-thiazol-5-yl)sulfonyl-propan-2-ylamino]ethanethioamide |
|---|---|
| PubChem CID | 103414692 |
| Molecular Formula | C9H15N3O2S3 |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-5-yl)sulfonyl-propan-2-ylamino]ethanethioamide |
| SMILES | Cc1ncc(S(=O)(=O)N(CC(N)=S)C(C)C)s1 |
| InChI | InChI=1S/C9H15N3O2S3/c1-6(2)12(5-8(10)15)17(13,14)9-4-11-7(3)16-9/h4,6H,5H2,1-3H3,(H2,10,15) |
| InChIKey | XWOBYCKZGDQLIV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|