C11H17BrN2O2S3 — CID 79987516
3-[(5-bromo-4-methylthiophen-2-yl)sulfonyl-propan-2-ylamino]propanethioamide (PubChem CID 79987516) has the molecular formula C11H17BrN2O2S3 and a molecular weight of 385.37 g/mol. Its IUPAC name is 3-[(5-bromo-4-methylthiophen-2-yl)sulfonyl-propan-2-ylamino]propanethioamide.
| Compound Name | 3-[(5-bromo-4-methylthiophen-2-yl)sulfonyl-propan-2-ylamino]propanethioamide |
|---|---|
| PubChem CID | 79987516 |
| Molecular Formula | C11H17BrN2O2S3 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | 3-[(5-bromo-4-methylthiophen-2-yl)sulfonyl-propan-2-ylamino]propanethioamide |
| SMILES | Cc1cc(S(=O)(=O)N(CCC(N)=S)C(C)C)sc1Br |
| InChI | InChI=1S/C11H17BrN2O2S3/c1-7(2)14(5-4-9(13)17)19(15,16)10-6-8(3)11(12)18-10/h6-7H,4-5H2,1-3H3,(H2,13,17) |
| InChIKey | FKPNBSWMJDTFGO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|