C9H13BrN2O2S3 — CID 79988073
3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]butanethioamide (PubChem CID 79988073) has the molecular formula C9H13BrN2O2S3 and a molecular weight of 357.32 g/mol. Its IUPAC name is 3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]butanethioamide.
| Compound Name | 3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]butanethioamide |
|---|---|
| PubChem CID | 79988073 |
| Molecular Formula | C9H13BrN2O2S3 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | 3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]butanethioamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C)CC(N)=S)sc1Br |
| InChI | InChI=1S/C9H13BrN2O2S3/c1-5-3-8(16-9(5)10)17(13,14)12-6(2)4-7(11)15/h3,6,12H,4H2,1-2H3,(H2,11,15) |
| InChIKey | BPQLBWMXCFUBJJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|