C10H16N2O2S3 — CID 62093885
3-[(5-ethylthiophen-2-yl)sulfonylamino]butanethioamide (PubChem CID 62093885) has the molecular formula C10H16N2O2S3 and a molecular weight of 292.45 g/mol. Its IUPAC name is 3-[(5-ethylthiophen-2-yl)sulfonylamino]butanethioamide.
| Compound Name | 3-[(5-ethylthiophen-2-yl)sulfonylamino]butanethioamide |
|---|---|
| PubChem CID | 62093885 |
| Molecular Formula | C10H16N2O2S3 |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 3-[(5-ethylthiophen-2-yl)sulfonylamino]butanethioamide |
| SMILES | CCc1ccc(S(=O)(=O)NC(C)CC(N)=S)s1 |
| InChI | InChI=1S/C10H16N2O2S3/c1-3-8-4-5-10(16-8)17(13,14)12-7(2)6-9(11)15/h4-5,7,12H,3,6H2,1-2H3,(H2,11,15) |
| InChIKey | UTTYDPIGDQYUBW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|