C10H16BrN3O3S2 — CID 79987550
2-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-N'-hydroxy-3-methylbutanimidamide (PubChem CID 79987550) has the molecular formula C10H16BrN3O3S2 and a molecular weight of 370.29 g/mol. Its IUPAC name is 2-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-N'-hydroxy-3-methylbutanimidamide.
| Compound Name | 2-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-N'-hydroxy-3-methylbutanimidamide |
|---|---|
| PubChem CID | 79987550 |
| Molecular Formula | C10H16BrN3O3S2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 2-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-N'-hydroxy-3-methylbutanimidamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C(N)=NO)C(C)C)sc1Br |
| InChI | InChI=1S/C10H16BrN3O3S2/c1-5(2)8(10(12)13-15)14-19(16,17)7-4-6(3)9(11)18-7/h4-5,8,14-15H,1-3H3,(H2,12,13) |
| InChIKey | MLYRNOKLDRRBCL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|