C8H12BrNO3S2 — CID 79988466
5-bromo-N-(1-hydroxypropan-2-yl)-4-methylthiophene-2-sulfonamide (PubChem CID 79988466) has the molecular formula C8H12BrNO3S2 and a molecular weight of 314.23 g/mol. Its IUPAC name is 5-bromo-N-(1-hydroxypropan-2-yl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(1-hydroxypropan-2-yl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79988466 |
| Molecular Formula | C8H12BrNO3S2 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 312.94 |
| IUPAC Name | 5-bromo-N-(1-hydroxypropan-2-yl)-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C)CO)sc1Br |
| InChI | InChI=1S/C8H12BrNO3S2/c1-5-3-7(14-8(5)9)15(12,13)10-6(2)4-11/h3,6,10-11H,4H2,1-2H3 |
| InChIKey | IJOMAFWDVQZUPO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |