C9H12BrNO2S2 — CID 115692248
5-bromo-N-but-3-en-2-yl-4-methylthiophene-2-sulfonamide (PubChem CID 115692248) has the molecular formula C9H12BrNO2S2 and a molecular weight of 310.24 g/mol. Its IUPAC name is 5-bromo-N-but-3-en-2-yl-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-but-3-en-2-yl-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 115692248 |
| Molecular Formula | C9H12BrNO2S2 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 308.95 |
| IUPAC Name | 5-bromo-N-but-3-en-2-yl-4-methylthiophene-2-sulfonamide |
| SMILES | C=CC(C)NS(=O)(=O)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C9H12BrNO2S2/c1-4-7(3)11-15(12,13)8-5-6(2)9(10)14-8/h4-5,7,11H,1H2,2-3H3 |
| InChIKey | RLOLWKCDASWQHB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|