C8H10BrNO2S2 — CID 79925847
5-bromo-4-methyl-N-prop-2-enylthiophene-2-sulfonamide (PubChem CID 79925847) has the molecular formula C8H10BrNO2S2 and a molecular weight of 296.21 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-prop-2-enylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-methyl-N-prop-2-enylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79925847 |
| Molecular Formula | C8H10BrNO2S2 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 294.93 |
| IUPAC Name | 5-bromo-4-methyl-N-prop-2-enylthiophene-2-sulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C8H10BrNO2S2/c1-3-4-10-14(11,12)7-5-6(2)8(9)13-7/h3,5,10H,1,4H2,2H3 |
| InChIKey | SYUDYWIPQCKBME-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|