C12H19Br2NO2S2 — CID 107158081
5-bromo-N-(2-bromo-4,4-dimethylpentyl)-4-methylthiophene-2-sulfonamide (PubChem CID 107158081) has the molecular formula C12H19Br2NO2S2 and a molecular weight of 433.23 g/mol. Its IUPAC name is 5-bromo-N-(2-bromo-4,4-dimethylpentyl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(2-bromo-4,4-dimethylpentyl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107158081 |
| Molecular Formula | C12H19Br2NO2S2 |
| Molecular Weight | 433.23 g/mol |
| Exact Mass | 430.92 |
| IUPAC Name | 5-bromo-N-(2-bromo-4,4-dimethylpentyl)-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC(Br)CC(C)(C)C)sc1Br |
| InChI | InChI=1S/C12H19Br2NO2S2/c1-8-5-10(18-11(8)14)19(16,17)15-7-9(13)6-12(2,3)4/h5,9,15H,6-7H2,1-4H3 |
| InChIKey | DFBIGJWMZHNSFV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|