C9H15BrN2O2S2 — CID 79989371
N-(1-amino-2-methylpropan-2-yl)-5-bromo-4-methylthiophene-2-sulfonamide (PubChem CID 79989371) has the molecular formula C9H15BrN2O2S2 and a molecular weight of 327.27 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-5-bromo-4-methylthiophene-2-sulfonamide.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-5-bromo-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79989371 |
| Molecular Formula | C9H15BrN2O2S2 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-5-bromo-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C)(C)CN)sc1Br |
| InChI | InChI=1S/C9H15BrN2O2S2/c1-6-4-7(15-8(6)10)16(13,14)12-9(2,3)5-11/h4,12H,5,11H2,1-3H3 |
| InChIKey | LBGPIVAAWFBPNS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |