C12H23ClN2O2S2 — CID 119975669
N-(1-amino-2-methylpropan-2-yl)-5-tert-butylthiophene-2-sulfonamide;hydrochloride (PubChem CID 119975669) has the molecular formula C12H23ClN2O2S2 and a molecular weight of 326.92 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-5-tert-butylthiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-5-tert-butylthiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119975669 |
| Molecular Formula | C12H23ClN2O2S2 |
| Molecular Weight | 326.92 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-5-tert-butylthiophene-2-sulfonamide;hydrochloride |
| SMILES | CC(C)(CN)NS(=O)(=O)c1ccc(C(C)(C)C)s1.Cl |
| InChI | InChI=1S/C12H22N2O2S2.ClH/c1-11(2,3)9-6-7-10(17-9)18(15,16)14-12(4,5)8-13;/h6-7,14H,8,13H2,1-5H3;1H |
| InChIKey | XSWTVSWCARCODW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.92 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |