C11H21ClN2O2S2 — CID 119981104
N-[3-(aminomethyl)pentan-3-yl]-5-methylthiophene-2-sulfonamide;hydrochloride (PubChem CID 119981104) has the molecular formula C11H21ClN2O2S2 and a molecular weight of 312.89 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-5-methylthiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-5-methylthiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119981104 |
| Molecular Formula | C11H21ClN2O2S2 |
| Molecular Weight | 312.89 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-5-methylthiophene-2-sulfonamide;hydrochloride |
| SMILES | CCC(CC)(CN)NS(=O)(=O)c1ccc(C)s1.Cl |
| InChI | InChI=1S/C11H20N2O2S2.ClH/c1-4-11(5-2,8-12)13-17(14,15)10-7-6-9(3)16-10;/h6-7,13H,4-5,8,12H2,1-3H3;1H |
| InChIKey | PZMUTCLZQNMWAM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.89 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |