C11H20BrClN2O2S2 — CID 119981138
N-[3-(aminomethyl)pentan-3-yl]-5-bromo-2-methylthiophene-3-sulfonamide;hydrochloride (PubChem CID 119981138) has the molecular formula C11H20BrClN2O2S2 and a molecular weight of 391.78 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-5-bromo-2-methylthiophene-3-sulfonamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-5-bromo-2-methylthiophene-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119981138 |
| Molecular Formula | C11H20BrClN2O2S2 |
| Molecular Weight | 391.78 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-5-bromo-2-methylthiophene-3-sulfonamide;hydrochloride |
| SMILES | CCC(CC)(CN)NS(=O)(=O)c1cc(Br)sc1C.Cl |
| InChI | InChI=1S/C11H19BrN2O2S2.ClH/c1-4-11(5-2,7-13)14-18(15,16)9-6-10(12)17-8(9)3;/h6,14H,4-5,7,13H2,1-3H3;1H |
| InChIKey | JHEPYFJFNYUVPW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |