C11H16BrNO2S2 — CID 115690387
5-bromo-N-(1-ethylcyclobutyl)-2-methylthiophene-3-sulfonamide (PubChem CID 115690387) has the molecular formula C11H16BrNO2S2 and a molecular weight of 338.29 g/mol. Its IUPAC name is 5-bromo-N-(1-ethylcyclobutyl)-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-bromo-N-(1-ethylcyclobutyl)-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 115690387 |
| Molecular Formula | C11H16BrNO2S2 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 5-bromo-N-(1-ethylcyclobutyl)-2-methylthiophene-3-sulfonamide |
| SMILES | CCC1(NS(=O)(=O)c2cc(Br)sc2C)CCC1 |
| InChI | InChI=1S/C11H16BrNO2S2/c1-3-11(5-4-6-11)13-17(14,15)9-7-10(12)16-8(9)2/h7,13H,3-6H2,1-2H3 |
| InChIKey | ASBBUVULAQTZIH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |