C10H14Br3NO2S2 — CID 107868332
5-bromo-N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-methylthiophene-3-sulfonamide (PubChem CID 107868332) has the molecular formula C10H14Br3NO2S2 and a molecular weight of 484.07 g/mol. Its IUPAC name is 5-bromo-N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-bromo-N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 107868332 |
| Molecular Formula | C10H14Br3NO2S2 |
| Molecular Weight | 484.07 g/mol |
| Exact Mass | 480.80 |
| IUPAC Name | 5-bromo-N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-methylthiophene-3-sulfonamide |
| SMILES | CCC(CBr)(CBr)NS(=O)(=O)c1cc(Br)sc1C |
| InChI | InChI=1S/C10H14Br3NO2S2/c1-3-10(5-11,6-12)14-18(15,16)8-4-9(13)17-7(8)2/h4,14H,3,5-6H2,1-2H3 |
| InChIKey | CLRUSJCUWSDMQJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.07 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|