C10H14BrCl2NO2S2 — CID 113271110
N-[3-(bromomethyl)pentan-3-yl]-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 113271110) has the molecular formula C10H14BrCl2NO2S2 and a molecular weight of 395.17 g/mol. Its IUPAC name is N-[3-(bromomethyl)pentan-3-yl]-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-[3-(bromomethyl)pentan-3-yl]-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 113271110 |
| Molecular Formula | C10H14BrCl2NO2S2 |
| Molecular Weight | 395.17 g/mol |
| Exact Mass | 392.90 |
| IUPAC Name | N-[3-(bromomethyl)pentan-3-yl]-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | CCC(CC)(CBr)NS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H14BrCl2NO2S2/c1-3-10(4-2,6-11)14-18(15,16)7-5-8(12)17-9(7)13/h5,14H,3-4,6H2,1-2H3 |
| InChIKey | MNUKCTQVOVPYAU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.17 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|