C13H19BrFNO2S — CID 114294064
N-[3-(bromomethyl)pentan-3-yl]-5-fluoro-2-methylbenzenesulfonamide (PubChem CID 114294064) has the molecular formula C13H19BrFNO2S and a molecular weight of 352.27 g/mol. Its IUPAC name is N-[3-(bromomethyl)pentan-3-yl]-5-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[3-(bromomethyl)pentan-3-yl]-5-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114294064 |
| Molecular Formula | C13H19BrFNO2S |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-[3-(bromomethyl)pentan-3-yl]-5-fluoro-2-methylbenzenesulfonamide |
| SMILES | CCC(CC)(CBr)NS(=O)(=O)c1cc(F)ccc1C |
| InChI | InChI=1S/C13H19BrFNO2S/c1-4-13(5-2,9-14)16-19(17,18)12-8-11(15)7-6-10(12)3/h6-8,16H,4-5,9H2,1-3H3 |
| InChIKey | DJELSWCYDRYFGO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|