C11H13Br2ClFNO2S — CID 107868294
N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-chloro-5-fluorobenzenesulfonamide (PubChem CID 107868294) has the molecular formula C11H13Br2ClFNO2S and a molecular weight of 437.56 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-chloro-5-fluorobenzenesulfonamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-chloro-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107868294 |
| Molecular Formula | C11H13Br2ClFNO2S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 434.87 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-chloro-5-fluorobenzenesulfonamide |
| SMILES | CCC(CBr)(CBr)NS(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C11H13Br2ClFNO2S/c1-2-11(6-12,7-13)16-19(17,18)10-5-8(15)3-4-9(10)14/h3-5,16H,2,6-7H2,1H3 |
| InChIKey | OYKQPIHQJHBFRT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|