C12H16Br2FNO2S — CID 114011011
N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-fluoro-2-methylbenzenesulfonamide (PubChem CID 114011011) has the molecular formula C12H16Br2FNO2S and a molecular weight of 417.14 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114011011 |
| Molecular Formula | C12H16Br2FNO2S |
| Molecular Weight | 417.14 g/mol |
| Exact Mass | 414.93 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-fluoro-2-methylbenzenesulfonamide |
| SMILES | CCC(CBr)(CBr)NS(=O)(=O)c1ccc(F)cc1C |
| InChI | InChI=1S/C12H16Br2FNO2S/c1-3-12(7-13,8-14)16-19(17,18)11-5-4-10(15)6-9(11)2/h4-6,16H,3,7-8H2,1-2H3 |
| InChIKey | WIMLARWXNFROCQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|