C10H10BrClFNO2S — CID 105400746
N-[1-(bromomethyl)cyclopropyl]-2-chloro-5-fluorobenzenesulfonamide (PubChem CID 105400746) has the molecular formula C10H10BrClFNO2S and a molecular weight of 342.62 g/mol. Its IUPAC name is N-[1-(bromomethyl)cyclopropyl]-2-chloro-5-fluorobenzenesulfonamide.
| Compound Name | N-[1-(bromomethyl)cyclopropyl]-2-chloro-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 105400746 |
| Molecular Formula | C10H10BrClFNO2S |
| Molecular Weight | 342.62 g/mol |
| Exact Mass | 340.93 |
| IUPAC Name | N-[1-(bromomethyl)cyclopropyl]-2-chloro-5-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1(CBr)CC1)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C10H10BrClFNO2S/c11-6-10(3-4-10)14-17(15,16)9-5-7(13)1-2-8(9)12/h1-2,5,14H,3-4,6H2 |
| InChIKey | RCZSKWKCVPKGCX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|