C14H18BrClFNO2S — CID 105400688
N-[1-(bromomethyl)-3-methylcyclohexyl]-2-chloro-5-fluorobenzenesulfonamide (PubChem CID 105400688) has the molecular formula C14H18BrClFNO2S and a molecular weight of 398.73 g/mol. Its IUPAC name is N-[1-(bromomethyl)-3-methylcyclohexyl]-2-chloro-5-fluorobenzenesulfonamide.
| Compound Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-2-chloro-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 105400688 |
| Molecular Formula | C14H18BrClFNO2S |
| Molecular Weight | 398.73 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-2-chloro-5-fluorobenzenesulfonamide |
| SMILES | CC1CCCC(CBr)(NS(=O)(=O)c2cc(F)ccc2Cl)C1 |
| InChI | InChI=1S/C14H18BrClFNO2S/c1-10-3-2-6-14(8-10,9-15)18-21(19,20)13-7-11(17)4-5-12(13)16/h4-5,7,10,18H,2-3,6,8-9H2,1H3 |
| InChIKey | ONQBGUNURUDZCO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|