C14H19ClFNO3S — CID 62525664
2-chloro-4-fluoro-N-[1-(hydroxymethyl)-3-methylcyclohexyl]benzenesulfonamide (PubChem CID 62525664) has the molecular formula C14H19ClFNO3S and a molecular weight of 335.83 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[1-(hydroxymethyl)-3-methylcyclohexyl]benzenesulfonamide.
| Compound Name | 2-chloro-4-fluoro-N-[1-(hydroxymethyl)-3-methylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62525664 |
| Molecular Formula | C14H19ClFNO3S |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-chloro-4-fluoro-N-[1-(hydroxymethyl)-3-methylcyclohexyl]benzenesulfonamide |
| SMILES | CC1CCCC(CO)(NS(=O)(=O)c2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C14H19ClFNO3S/c1-10-3-2-6-14(8-10,9-18)17-21(19,20)13-5-4-11(16)7-12(13)15/h4-5,7,10,17-18H,2-3,6,8-9H2,1H3 |
| InChIKey | YMIYVCUQTWTPDV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |