C12H14BrClFNO3S — CID 106301301
N-[4-(bromomethyl)oxan-4-yl]-2-chloro-5-fluorobenzenesulfonamide (PubChem CID 106301301) has the molecular formula C12H14BrClFNO3S and a molecular weight of 386.67 g/mol. Its IUPAC name is N-[4-(bromomethyl)oxan-4-yl]-2-chloro-5-fluorobenzenesulfonamide.
| Compound Name | N-[4-(bromomethyl)oxan-4-yl]-2-chloro-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106301301 |
| Molecular Formula | C12H14BrClFNO3S |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | N-[4-(bromomethyl)oxan-4-yl]-2-chloro-5-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1(CBr)CCOCC1)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C12H14BrClFNO3S/c13-8-12(3-5-19-6-4-12)16-20(17,18)11-7-9(15)1-2-10(11)14/h1-2,7,16H,3-6,8H2 |
| InChIKey | UECSJKPLCWWGOW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|