C12H12F5NO3S — CID 86770880
2,5-difluoro-N-[4-(trifluoromethyl)oxan-4-yl]benzenesulfonamide (PubChem CID 86770880) has the molecular formula C12H12F5NO3S and a molecular weight of 345.29 g/mol. Its IUPAC name is 2,5-difluoro-N-[4-(trifluoromethyl)oxan-4-yl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[4-(trifluoromethyl)oxan-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 86770880 |
| Molecular Formula | C12H12F5NO3S |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2,5-difluoro-N-[4-(trifluoromethyl)oxan-4-yl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1(C(F)(F)F)CCOCC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H12F5NO3S/c13-8-1-2-9(14)10(7-8)22(19,20)18-11(12(15,16)17)3-5-21-6-4-11/h1-2,7,18H,3-6H2 |
| InChIKey | URRHTOLAUJAVOD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |