C13H16F2N2O2S2 — CID 61124069
1-[(2,5-difluorophenyl)sulfonylamino]cyclohexane-1-carbothioamide (PubChem CID 61124069) has the molecular formula C13H16F2N2O2S2 and a molecular weight of 334.41 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)sulfonylamino]cyclohexane-1-carbothioamide.
| Compound Name | 1-[(2,5-difluorophenyl)sulfonylamino]cyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 61124069 |
| Molecular Formula | C13H16F2N2O2S2 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-[(2,5-difluorophenyl)sulfonylamino]cyclohexane-1-carbothioamide |
| SMILES | NC(=S)C1(NS(=O)(=O)c2cc(F)ccc2F)CCCCC1 |
| InChI | InChI=1S/C13H16F2N2O2S2/c14-9-4-5-10(15)11(8-9)21(18,19)17-13(12(16)20)6-2-1-3-7-13/h4-5,8,17H,1-3,6-7H2,(H2,16,20) |
| InChIKey | SOKDIVXWNNSTRG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|