C13H20N2O2S3 — CID 61123756
1-(thiophen-2-ylsulfonylamino)cyclooctane-1-carbothioamide (PubChem CID 61123756) has the molecular formula C13H20N2O2S3 and a molecular weight of 332.52 g/mol. Its IUPAC name is 1-(thiophen-2-ylsulfonylamino)cyclooctane-1-carbothioamide.
| Compound Name | 1-(thiophen-2-ylsulfonylamino)cyclooctane-1-carbothioamide |
|---|---|
| PubChem CID | 61123756 |
| Molecular Formula | C13H20N2O2S3 |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1-(thiophen-2-ylsulfonylamino)cyclooctane-1-carbothioamide |
| SMILES | NC(=S)C1(NS(=O)(=O)c2cccs2)CCCCCCC1 |
| InChI | InChI=1S/C13H20N2O2S3/c14-12(18)13(8-4-2-1-3-5-9-13)15-20(16,17)11-7-6-10-19-11/h6-7,10,15H,1-5,8-9H2,(H2,14,18) |
| InChIKey | JPJLVSLEDVXBHH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|