C10H11F3N2O2S — CID 114158366
2-amino-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide (PubChem CID 114158366) has the molecular formula C10H11F3N2O2S and a molecular weight of 280.27 g/mol. Its IUPAC name is 2-amino-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide.
| Compound Name | 2-amino-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 114158366 |
| Molecular Formula | C10H11F3N2O2S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-amino-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide |
| SMILES | Nc1ccccc1S(=O)(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H11F3N2O2S/c11-10(12,13)9(5-6-9)15-18(16,17)8-4-2-1-3-7(8)14/h1-4,15H,5-6,14H2 |
| InChIKey | PQWJVBCVAQQEML-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|