C10H12F3N3O2S — CID 106217438
2-(aminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-sulfonamide (PubChem CID 106217438) has the molecular formula C10H12F3N3O2S and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106217438 |
| Molecular Formula | C10H12F3N3O2S |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-(aminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-sulfonamide |
| SMILES | NCc1ncccc1S(=O)(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H12F3N3O2S/c11-10(12,13)9(3-4-9)16-19(17,18)8-2-1-5-15-7(8)6-14/h1-2,5,16H,3-4,6,14H2 |
| InChIKey | KVUILPBWWWIAIB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |