C9H13F3N4O2S — CID 106218688
3-(aminomethyl)-5-methyl-N-[1-(trifluoromethyl)cyclopropyl]-1H-pyrazole-4-sulfonamide (PubChem CID 106218688) has the molecular formula C9H13F3N4O2S and a molecular weight of 298.29 g/mol. Its IUPAC name is 3-(aminomethyl)-5-methyl-N-[1-(trifluoromethyl)cyclopropyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 3-(aminomethyl)-5-methyl-N-[1-(trifluoromethyl)cyclopropyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106218688 |
| Molecular Formula | C9H13F3N4O2S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 3-(aminomethyl)-5-methyl-N-[1-(trifluoromethyl)cyclopropyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]nc(CN)c1S(=O)(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H13F3N4O2S/c1-5-7(6(4-13)15-14-5)19(17,18)16-8(2-3-8)9(10,11)12/h16H,2-4,13H2,1H3,(H,14,15) |
| InChIKey | VQGKPMOJMPPQIO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |