C10H21N5O2S — CID 106055948
3-(aminomethyl)-N-[2-[ethyl(methyl)amino]ethyl]-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 106055948) has the molecular formula C10H21N5O2S and a molecular weight of 275.38 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[2-[ethyl(methyl)amino]ethyl]-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | 3-(aminomethyl)-N-[2-[ethyl(methyl)amino]ethyl]-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106055948 |
| Molecular Formula | C10H21N5O2S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 3-(aminomethyl)-N-[2-[ethyl(methyl)amino]ethyl]-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | CCN(C)CCNS(=O)(=O)c1c(CN)n[nH]c1C |
| InChI | InChI=1S/C10H21N5O2S/c1-4-15(3)6-5-12-18(16,17)10-8(2)13-14-9(10)7-11/h12H,4-7,11H2,1-3H3,(H,13,14) |
| InChIKey | ZOZPGXGWRVNYST-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |