C11H18N6O2S — CID 106085795
3-(aminomethyl)-5-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 106085795) has the molecular formula C11H18N6O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 3-(aminomethyl)-5-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 3-(aminomethyl)-5-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106085795 |
| Molecular Formula | C11H18N6O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-(aminomethyl)-5-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]nc(CN)c1S(=O)(=O)NCCc1ccnn1C |
| InChI | InChI=1S/C11H18N6O2S/c1-8-11(10(7-12)16-15-8)20(18,19)14-6-4-9-3-5-13-17(9)2/h3,5,14H,4,6-7,12H2,1-2H3,(H,15,16) |
| InChIKey | PCTDWMQHZMGYRP-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |