C9H11F3N4O3S — CID 106219411
5-methyl-4-sulfamoyl-N-[1-(trifluoromethyl)cyclopropyl]-1H-pyrazole-3-carboxamide (PubChem CID 106219411) has the molecular formula C9H11F3N4O3S and a molecular weight of 312.27 g/mol. Its IUPAC name is 5-methyl-4-sulfamoyl-N-[1-(trifluoromethyl)cyclopropyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-4-sulfamoyl-N-[1-(trifluoromethyl)cyclopropyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 106219411 |
| Molecular Formula | C9H11F3N4O3S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-methyl-4-sulfamoyl-N-[1-(trifluoromethyl)cyclopropyl]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NC2(C(F)(F)F)CC2)c1S(N)(=O)=O |
| InChI | InChI=1S/C9H11F3N4O3S/c1-4-6(20(13,18)19)5(16-15-4)7(17)14-8(2-3-8)9(10,11)12/h2-3H2,1H3,(H,14,17)(H,15,16)(H2,13,18,19) |
| InChIKey | KWZOWHIADGGMKB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |