C10H11F3N2O2S — CID 106214723
3-methylsulfonyl-N-[1-(trifluoromethyl)cyclopropyl]pyridin-2-amine (PubChem CID 106214723) has the molecular formula C10H11F3N2O2S and a molecular weight of 280.27 g/mol. Its IUPAC name is 3-methylsulfonyl-N-[1-(trifluoromethyl)cyclopropyl]pyridin-2-amine.
| Compound Name | 3-methylsulfonyl-N-[1-(trifluoromethyl)cyclopropyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106214723 |
| Molecular Formula | C10H11F3N2O2S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3-methylsulfonyl-N-[1-(trifluoromethyl)cyclopropyl]pyridin-2-amine |
| SMILES | CS(=O)(=O)c1cccnc1NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H11F3N2O2S/c1-18(16,17)7-3-2-6-14-8(7)15-9(4-5-9)10(11,12)13/h2-3,6H,4-5H2,1H3,(H,14,15) |
| InChIKey | QEMFJQPQZAGGGB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |