C11H19N3O4S2 — CID 114598887
N-[2-methyl-1-[(3-methylsulfonyl-2-pyridinyl)amino]propan-2-yl]methanesulfonamide (PubChem CID 114598887) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[2-methyl-1-[(3-methylsulfonyl-2-pyridinyl)amino]propan-2-yl]methanesulfonamide.
| Compound Name | N-[2-methyl-1-[(3-methylsulfonyl-2-pyridinyl)amino]propan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 114598887 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-[2-methyl-1-[(3-methylsulfonyl-2-pyridinyl)amino]propan-2-yl]methanesulfonamide |
| SMILES | CC(C)(CNc1ncccc1S(C)(=O)=O)NS(C)(=O)=O |
| InChI | InChI=1S/C11H19N3O4S2/c1-11(2,14-20(4,17)18)8-13-10-9(19(3,15)16)6-5-7-12-10/h5-7,14H,8H2,1-4H3,(H,12,13) |
| InChIKey | JUXUQHVVRFUQGL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |