C11H17N3O3S — CID 114598664
2-[(3-methylsulfonyl-2-pyridinyl)amino]-N-propan-2-ylacetamide (PubChem CID 114598664) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-[(3-methylsulfonyl-2-pyridinyl)amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[(3-methylsulfonyl-2-pyridinyl)amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 114598664 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-[(3-methylsulfonyl-2-pyridinyl)amino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNc1ncccc1S(C)(=O)=O |
| InChI | InChI=1S/C11H17N3O3S/c1-8(2)14-10(15)7-13-11-9(18(3,16)17)5-4-6-12-11/h4-6,8H,7H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | VSRRYFSITKPORM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |