C11H18N2O3S — CID 114598966
3-methyl-2-[(3-methylsulfonyl-2-pyridinyl)amino]butan-1-ol (PubChem CID 114598966) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-methyl-2-[(3-methylsulfonyl-2-pyridinyl)amino]butan-1-ol.
| Compound Name | 3-methyl-2-[(3-methylsulfonyl-2-pyridinyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 114598966 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-methyl-2-[(3-methylsulfonyl-2-pyridinyl)amino]butan-1-ol |
| SMILES | CC(C)C(CO)Nc1ncccc1S(C)(=O)=O |
| InChI | InChI=1S/C11H18N2O3S/c1-8(2)9(7-14)13-11-10(17(3,15)16)5-4-6-12-11/h4-6,8-9,14H,7H2,1-3H3,(H,12,13) |
| InChIKey | GHIRNPVFNHZMAK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |