C12H20N2O3S — CID 114598927
N-(1-methoxy-3-methylbutan-2-yl)-3-methylsulfonylpyridin-2-amine (PubChem CID 114598927) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is N-(1-methoxy-3-methylbutan-2-yl)-3-methylsulfonylpyridin-2-amine.
| Compound Name | N-(1-methoxy-3-methylbutan-2-yl)-3-methylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 114598927 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-(1-methoxy-3-methylbutan-2-yl)-3-methylsulfonylpyridin-2-amine |
| SMILES | COCC(Nc1ncccc1S(C)(=O)=O)C(C)C |
| InChI | InChI=1S/C12H20N2O3S/c1-9(2)10(8-17-3)14-12-11(18(4,15)16)6-5-7-13-12/h5-7,9-10H,8H2,1-4H3,(H,13,14) |
| InChIKey | NWKQBLPIKSVOSO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |