C11H17ClN2O3S — CID 114150906
N-(4-chloro-1-methoxybutan-2-yl)-3-methylsulfonylpyridin-2-amine (PubChem CID 114150906) has the molecular formula C11H17ClN2O3S and a molecular weight of 292.79 g/mol. Its IUPAC name is N-(4-chloro-1-methoxybutan-2-yl)-3-methylsulfonylpyridin-2-amine.
| Compound Name | N-(4-chloro-1-methoxybutan-2-yl)-3-methylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 114150906 |
| Molecular Formula | C11H17ClN2O3S |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-(4-chloro-1-methoxybutan-2-yl)-3-methylsulfonylpyridin-2-amine |
| SMILES | COCC(CCCl)Nc1ncccc1S(C)(=O)=O |
| InChI | InChI=1S/C11H17ClN2O3S/c1-17-8-9(5-6-12)14-11-10(18(2,15)16)4-3-7-13-11/h3-4,7,9H,5-6,8H2,1-2H3,(H,13,14) |
| InChIKey | REMLVCUEPHLXQW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|