C12H19ClN2O2 — CID 106154134
N-(4-chloro-1-methoxybutan-2-yl)-3-ethoxypyridin-2-amine (PubChem CID 106154134) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is N-(4-chloro-1-methoxybutan-2-yl)-3-ethoxypyridin-2-amine.
| Compound Name | N-(4-chloro-1-methoxybutan-2-yl)-3-ethoxypyridin-2-amine |
|---|---|
| PubChem CID | 106154134 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | N-(4-chloro-1-methoxybutan-2-yl)-3-ethoxypyridin-2-amine |
| SMILES | CCOc1cccnc1NC(CCCl)COC |
| InChI | InChI=1S/C12H19ClN2O2/c1-3-17-11-5-4-8-14-12(11)15-10(6-7-13)9-16-2/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,14,15) |
| InChIKey | VTQPCTMTBSTZSK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|