C12H21N3O2 — CID 114155004
3-methoxy-2-N-(3-propoxy-2-pyridinyl)propane-1,2-diamine (PubChem CID 114155004) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 3-methoxy-2-N-(3-propoxy-2-pyridinyl)propane-1,2-diamine.
| Compound Name | 3-methoxy-2-N-(3-propoxy-2-pyridinyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 114155004 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 3-methoxy-2-N-(3-propoxy-2-pyridinyl)propane-1,2-diamine |
| SMILES | CCCOc1cccnc1NC(CN)COC |
| InChI | InChI=1S/C12H21N3O2/c1-3-7-17-11-5-4-6-14-12(11)15-10(8-13)9-16-2/h4-6,10H,3,7-9,13H2,1-2H3,(H,14,15) |
| InChIKey | WTKOREASSBDFRI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |