C15H27N3O — CID 106142911
2,2-dimethyl-N-(3-propoxy-2-pyridinyl)pentane-1,5-diamine (PubChem CID 106142911) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 2,2-dimethyl-N-(3-propoxy-2-pyridinyl)pentane-1,5-diamine.
| Compound Name | 2,2-dimethyl-N-(3-propoxy-2-pyridinyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 106142911 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 2,2-dimethyl-N-(3-propoxy-2-pyridinyl)pentane-1,5-diamine |
| SMILES | CCCOc1cccnc1NCC(C)(C)CCCN |
| InChI | InChI=1S/C15H27N3O/c1-4-11-19-13-7-5-10-17-14(13)18-12-15(2,3)8-6-9-16/h5,7,10H,4,6,8-9,11-12,16H2,1-3H3,(H,17,18) |
| InChIKey | MPUXQMJKCDVCLW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |