C13H18N2O — CID 106222583
N-pent-4-ynyl-3-propoxypyridin-2-amine (PubChem CID 106222583) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N-pent-4-ynyl-3-propoxypyridin-2-amine.
| Compound Name | N-pent-4-ynyl-3-propoxypyridin-2-amine |
|---|---|
| PubChem CID | 106222583 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-pent-4-ynyl-3-propoxypyridin-2-amine |
| SMILES | C#CCCCNc1ncccc1OCCC |
| InChI | InChI=1S/C13H18N2O/c1-3-5-6-9-14-13-12(16-11-4-2)8-7-10-15-13/h1,7-8,10H,4-6,9,11H2,2H3,(H,14,15) |
| InChIKey | CASVADRUKHKZND-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|