C13H22N2O2 — CID 106129002
5-[(3-propoxy-2-pyridinyl)amino]pentan-2-ol (PubChem CID 106129002) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 5-[(3-propoxy-2-pyridinyl)amino]pentan-2-ol.
| Compound Name | 5-[(3-propoxy-2-pyridinyl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 106129002 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 5-[(3-propoxy-2-pyridinyl)amino]pentan-2-ol |
| SMILES | CCCOc1cccnc1NCCCC(C)O |
| InChI | InChI=1S/C13H22N2O2/c1-3-10-17-12-7-5-9-15-13(12)14-8-4-6-11(2)16/h5,7,9,11,16H,3-4,6,8,10H2,1-2H3,(H,14,15) |
| InChIKey | AVTHUYALWJPMHK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|